CAS 932233-33-5

pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one

Description:

Pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one is a heterocyclic compound characterized by a fused ring system that incorporates both pyridine and triazole moieties. This compound features a pyrimidinone structure, which contributes to its potential biological activity. The presence of nitrogen atoms in the rings enhances its ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and material science. Its unique structure may impart specific pharmacological properties, potentially influencing its interactions with biological targets. The compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by substituents on the rings. As with many heterocycles, it may exhibit solubility in polar solvents and possess moderate stability under standard conditions. Research into this compound may focus on its applications in drug development, particularly in areas such as oncology or infectious diseases, where novel scaffolds are sought for therapeutic agents.

Formula: C₈H₅N₅O

InChI: InChI=1/C8H5N5O/c14-7-5-3-10-8-11-4-12-13(8)6(5)1-2-9-7/h1-4H,(H,9,14)

SMILES: c1cnc(c2cnc3ncnn3c12)O

Pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one

CAS: 932233-33-5

Purity: 95.0%

Molecular weight: 187.16200256347656

Ref: 10-F311648