CAS 93236-67-0
:Senkyunolide B
Description:
Senkyunolide B is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant species *Ligusticum chuanxiong*, commonly known in traditional medicine. This compound is characterized by its unique bicyclic structure, which contributes to its biological activity. Senkyunolide B exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and neuroprotective effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves modulation of signaling pathways related to inflammation and oxidative stress. Additionally, Senkyunolide B has been studied for its potential therapeutic applications in conditions such as cardiovascular diseases and neurodegenerative disorders. The compound is typically analyzed using techniques such as chromatography and mass spectrometry to determine its purity and concentration in research settings. Overall, Senkyunolide B represents a significant area of interest for researchers exploring natural products and their potential health benefits.
Formula:C12H12O3
InChI:InChI=1/C12H12O3/c1-2-3-7-10-8-5-4-6-9(13)11(8)12(14)15-10/h4-7,13H,2-3H2,1H3/b10-7-
InChI key:InChIKey=XLFDJKJEYMKLJX-YFHOEESVSA-N
SMILES:C(\CCC)=C\1/C=2C(C(=O)O1)=C(O)C=CC2
Synonyms:- 1(3H)-Isobenzofuranone, 3-butylidene-7-hydroxy-, (3Z)-
- Senkyunolide B
- 3-Butylidene-7-hydroxyphthalide
- 1(3H)-Isobenzofuranone, 3-butylidene-7-hydroxy-, (Z)-
- (3Z)-3-Butylidene-7-hydroxy-1(3H)-isobenzofuranone
- (Z)-3-Butylidene-7-hydroxyisobenzofuran-1(3H)-one
- 3-[(Z)-Butylidene]-7-hydroxy-1(3H)-isobenzofuranone
- (Z)-3-butylidene-7-hydroxyphthalide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Butylidene-7-hydroxyphthalide
CAS:Controlled Product<p>Applications 3-Butylidene-7-hydroxyphthalide is a phthalide extracted from rhizome of Ligusticum wallichii. A useful intermediate for organic synthesis.<br>References Wang, P., et al.: Phytochemistry, 23, 2033 (1984); Mali, R. S., et al.: Synth. Commun., 20, 167 (1990); Ogawa, Y., et al.: Heterocycles, 39, 47 (1994)<br></p>Formula:C12H12O3Color and Shape:NeatMolecular weight:204.23
