CymitQuimica logo

CAS 932372-99-1

:

2-bromo-5-iodo-phenol

Description:
2-Bromo-5-iodo-phenol is an organic compound characterized by the presence of both bromine and iodine substituents on a phenolic ring. The compound features a bromine atom at the second position and an iodine atom at the fifth position of the benzene ring, which influences its chemical reactivity and physical properties. As a phenolic compound, it exhibits typical characteristics such as the ability to form hydrogen bonds due to the hydroxyl (-OH) group, which contributes to its solubility in polar solvents. The presence of halogens (bromine and iodine) can enhance its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure and substituents can affect its melting point, boiling point, and spectral properties, making it a subject of interest in both academic and industrial research. Safety precautions should be taken when handling this compound due to the potential hazards associated with halogenated organic compounds.
Formula:C6H4BrIO
InChI:InChI=1/C6H4BrIO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H
InChI key:VRITXTVQJJMQIT-UHFFFAOYSA-N
SMILES:c1cc(c(cc1I)O)Br
Synonyms:
  • 2-Bromo-5-Iodophenol
  • Phenol, 2-Bromo-5-Iodo-
Found 4 products.