CAS 932382-18-8
:N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxamide
Description:
N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a dioxaborolane moiety. The presence of the diethyl group enhances its solubility and potential biological activity. This compound is notable for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the boron-containing dioxaborolane, which can participate in various chemical reactions, including those involving boron-mediated transformations. The pyridinecarboxamide portion contributes to its ability to interact with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tetramethyl groups. Overall, this compound exemplifies the integration of boron chemistry with organic synthesis, showcasing its potential utility in drug design and development.
Formula:C16H25BN2O3
InChI:InChI=1S/C16H25BN2O3/c1-7-19(8-2)14(20)12-11-18-10-9-13(12)17-21-15(3,4)16(5,6)22-17/h9-11H,7-8H2,1-6H3
InChI key:InChIKey=LEZXVYUDYOCPGO-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C=1C(=CC=NC1)B2OC(C)(C)C(C)(C)O2
Synonyms:- N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Diethylcarbamoyl)pyridine-4-boronic acid pinacol ester
CAS:Formula:C16H25BN2O3Molecular weight:304.1923
