CAS 932390-39-1

B-[4-(Hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic-10B acid

Description:

B-[4-(Hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic-10B acid, with the CAS number 932390-39-1, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that features both a hydroxymethyl and a trifluoromethyl substituent. This compound is notable for its boron-10 isotope, which can be utilized in various applications, including nuclear medicine and neutron capture therapy. The hydroxymethyl group enhances its solubility in polar solvents, while the trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and interaction with biological systems. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in organic synthesis and as intermediates in the development of pharmaceuticals. Additionally, the presence of the trifluoromethyl group may impart unique electronic properties, potentially affecting the compound's reactivity and stability. Overall, this compound exemplifies the diverse functionalities that can be achieved through strategic molecular design in boron chemistry.

Formula: C₈H₈BF₃O₃

InChI: InChI=1S/C8H8BF3O3/c10-8(11,12)7-3-6(9(14)15)2-1-5(7)4-13/h1-3,13-15H,4H2/i9-1

InChI key: InChIKey=JOMSLFNOGULATK-RVRFMXCPSA-N

SMILES: C(F)(F)(F)C1=C(CO)C=CC([10B](O)O)=C1

Synonyms:

• Boronic-10B acid, B-[4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]-
• B-[4-(Hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic-10B acid

[4-(Hydroxymethyl)-3-(trifluoromethyl)phenyl]boronic acid

CAS: 932390-39-1

Formula: C₈H₈BF₃O₃

Purity: 95%

Molecular weight: 219.9535

Ref: IN-DA019D3R