CAS 93245-26-2
:2,2,2-trifluoro-N-(4-{[6-methoxy-5-(trifluoroacetyl)quinolin-8-yl]amino}pentyl)acetamide
Description:
2,2,2-Trifluoro-N-(4-{[6-methoxy-5-(trifluoroacetyl)quinolin-8-yl]amino}pentyl)acetamide, with CAS number 93245-26-2, is a synthetic organic compound characterized by its complex structure, which includes a trifluoroacetyl group and a quinoline moiety. This compound features multiple functional groups, including an amide and a methoxy group, contributing to its potential biological activity. The presence of trifluoromethyl groups enhances lipophilicity and may influence the compound's pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the context of targeting specific biological pathways or receptors. The quinoline structure is often associated with various biological activities, including antimicrobial and anticancer properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of fluorine atoms, which can alter electronic properties and intermolecular interactions. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C19H19F6N3O3
InChI:InChI=1/C19H19F6N3O3/c1-10(5-3-8-27-17(30)19(23,24)25)28-12-9-13(31-2)14(16(29)18(20,21)22)11-6-4-7-26-15(11)12/h4,6-7,9-10,28H,3,5,8H2,1-2H3,(H,27,30)
SMILES:CC(CCCN=C(C(F)(F)F)O)Nc1cc(c(c2cccnc12)C(=O)C(F)(F)F)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.