CAS 93249-67-3
:(4E)-2-methoxy-4-[(methoxyamino)methylidene]cyclohexa-2,5-dien-1-one
Description:
(4E)-2-methoxy-4-[(methoxyamino)methylidene]cyclohexa-2,5-dien-1-one, with the CAS number 93249-67-3, is an organic compound characterized by its unique structure, which includes a cyclohexadiene core with various functional groups. This compound features a methoxy group and a methoxyamino group, contributing to its reactivity and potential applications in organic synthesis. The presence of the conjugated diene system suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic additions or substitutions. Its structural configuration, particularly the E-configuration of the double bond, may influence its stereochemistry and biological activity. Compounds of this nature are often studied for their potential roles in pharmaceuticals or as intermediates in chemical synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of functionalized cyclic compounds.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-12-9-5-7(6-10-13-2)3-4-8(9)11/h3-6,10H,1-2H3/b7-6+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.