CAS 93254-88-7

1,1,1,5,5,5-Hexamethyltrisiloxane

Description:

1,1,1,5,5,5-Hexamethyltrisiloxane, with the CAS number 93254-88-7, is a siloxane compound characterized by its unique structure comprising three silicon atoms and a series of methyl groups attached to them. This compound is part of a larger class of organosilicon compounds known for their versatility and stability. It typically exhibits low viscosity and high thermal stability, making it suitable for various applications, including as a lubricant, a surfactant, and in cosmetic formulations. The presence of multiple methyl groups contributes to its hydrophobic properties, enhancing its effectiveness in repelling water and providing a smooth texture. Additionally, hexamethyltrisiloxane is generally considered to have low toxicity, which is advantageous for its use in consumer products. Its chemical stability and resistance to degradation under heat and UV light further enhance its utility in industrial and commercial applications. Overall, this compound exemplifies the functional characteristics of siloxanes, combining flexibility, stability, and low surface tension.

Formula: C₆H₂₀O₂Si₃

InChI: InChI=1S/C6H20O2Si3/c1-10(2,3)7-9-8-11(4,5)6/h9H2,1-6H3

InChI key: InChIKey=JHKBMYNOLVYFHD-UHFFFAOYSA-N

SMILES: O([Si](C)(C)C)[SiH2]O[Si](C)(C)C

Synonyms:

• 2,2,6,6-Tetramethyl-3,5-dioxa-2,4,6-trisilaheptane
• Trisiloxane, 1,1,1,5,5,5-hexamethyl-
• 1,1,1,5,5,5-Hexamethyltrisiloxane