CymitQuimica logo

CAS 93259-40-6

:

(2E,4E)-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one

Description:
The chemical substance known as (2E,4E)-1-(4-bromophenyl)-5-phenylpenta-2,4-dien-1-one, with the CAS number 93259-40-6, is an organic compound characterized by its conjugated diene system and a ketone functional group. This compound features a pentadiene backbone with two double bonds located at the 2 and 4 positions, contributing to its potential for various chemical reactivity and stability. The presence of a 4-bromophenyl group enhances its electronic properties, making it a candidate for applications in organic synthesis and materials science. The phenyl substituent at the 5-position adds to its aromatic character, which can influence its solubility and interaction with other molecules. The compound's structural features suggest it may exhibit interesting optical properties, potentially making it useful in photonic applications. Additionally, the bromine atom can serve as a site for further functionalization, allowing for the development of more complex chemical entities. Overall, this compound's unique structure positions it as a valuable subject for research in organic chemistry and related fields.
Formula:C17H13BrO
InChI:InChI=1/C17H13BrO/c18-16-12-10-15(11-13-16)17(19)9-5-4-8-14-6-2-1-3-7-14/h1-13H/b8-4+,9-5+
Synonyms:
  • (2E,4E)-1-(4-Bromophenyl)-5-phenylpenta-2,4-dien-1-one
  • 2,4-pentadien-1-one, 1-(4-bromophenyl)-5-phenyl-, (2E,4E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.