CAS 93264-02-9
:5,5-difluoro-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Description:
5,5-Difluoro-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one, identified by its CAS number 93264-02-9, is a bicyclic organic compound characterized by a unique bicyclo[2.2.1]heptane structure. This compound features two fluorine atoms at the 5-position and three methyl groups at the 1, 7, and 7 positions, contributing to its distinct chemical properties. The presence of the ketone functional group at the 2-position enhances its reactivity and solubility in various organic solvents. The fluorine substituents can influence the compound's polarity and stability, making it of interest in various chemical applications, including potential use in pharmaceuticals and agrochemicals. Additionally, the steric hindrance introduced by the bulky methyl groups may affect its conformational flexibility and interactions with other molecules. Overall, this compound exemplifies the complexity and diversity of bicyclic structures in organic chemistry, showcasing how modifications can lead to significant changes in chemical behavior and potential applications.
Formula:C10H14F2O
InChI:InChI=1/C10H14F2O/c1-8(2)6-4-7(13)9(8,3)5-10(6,11)12/h6H,4-5H2,1-3H3
SMILES:CC1(C)C2CC(=O)C1(C)CC2(F)F
Synonyms:- Bicyclo(2.2.1)heptan-2-one, 5,5-difluoro-1,7,7-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.