CymitQuimica logo

CAS 932702-23-3

:

Ethyl 6-aminobenzo[d]isoxazole-3-carboxylate

Description:
Ethyl 6-aminobenzo[d]isoxazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes an isoxazole ring fused to a benzene ring, along with an ethyl ester functional group and an amino substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The isoxazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the ethyl ester group may influence its pharmacokinetic properties, such as absorption and metabolism. The compound's specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, Ethyl 6-aminobenzo[d]isoxazole-3-carboxylate represents a versatile scaffold for further chemical modifications and applications in research.
Formula:C10H10N2O3
InChI:InChI=1/C10H10N2O3/c1-2-14-10(13)9-7-4-3-6(11)5-8(7)15-12-9/h3-5H,2,11H2,1H3
SMILES:CCOC(=O)c1c2ccc(cc2on1)N
Synonyms:
  • 6-Amino-1,2-benzisoxazole-3-carboxylic acid ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.