CymitQuimica logo

CAS 932702-24-4

:

Isothiazolo[5,4-b]pyridine-3-carboxylic acid

Description:
Isothiazolo[5,4-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both isothiazole and pyridine moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the carboxylic acid functional group contributes to its solubility in polar solvents and can influence its reactivity and interaction with biological targets. Isothiazolo[5,4-b]pyridine derivatives are often studied for their potential as antimicrobial, anti-inflammatory, or anticancer agents. The compound's molecular structure allows for various substitution patterns, which can further modulate its pharmacological properties. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Isothiazolo[5,4-b]pyridine-3-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research, with ongoing studies aimed at elucidating its full potential in therapeutic applications.
Formula:C7H4N2O2S
InChI:InChI=1S/C7H4N2O2S/c10-7(11)5-4-2-1-3-8-6(4)12-9-5/h1-3H,(H,10,11)
InChI key:InChIKey=MNBJEUWONPHKSB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(SN1)=NC=CC2
Synonyms:
  • Isothiazolo[5,4-b]pyridine-3-carboxylic acid
  • [1,2]Thiazolo[5,4-b]pyridine-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.