CAS 932702-33-5
:6-Hydroxybenzo[d]isothiazole-3-carboxylic acid
Description:
6-Hydroxybenzo[d]isothiazole-3-carboxylic acid is a heterocyclic compound characterized by the presence of a benzo[d]isothiazole ring system, which incorporates both sulfur and nitrogen atoms. This compound features a hydroxyl group (-OH) at the 6-position and a carboxylic acid group (-COOH) at the 3-position, contributing to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit properties such as acidity and the ability to participate in hydrogen bonding, which can influence its solubility and reactivity. Additionally, the isothiazole moiety may impart unique electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The compound's structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Its CAS number, 932702-33-5, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in scientific research.
Formula:C8H5NO3S
InChI:InChI=1/C8H5NO3S/c10-4-1-2-5-6(3-4)13-9-7(5)8(11)12/h1-3,10H,(H,11,12)
SMILES:c1cc2c(cc1O)snc2C(=O)O
Synonyms:- 6-Hydroxy-1,2-benzisothiazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
