CAS 932710-48-0
:(1E,5E)-N,N'-bis[(pentafluorobenzyl)oxy]pentane-1,5-diimine
Description:
(1E,5E)-N,N'-bis[(pentafluorobenzyl)oxy]pentane-1,5-diimine is a synthetic organic compound characterized by its unique structure, which includes two imine functional groups and pentafluorobenzyl ether moieties. The presence of the pentafluorobenzyl groups imparts significant electron-withdrawing properties, enhancing the compound's reactivity and stability in various chemical environments. This compound is likely to exhibit low solubility in non-polar solvents due to its polar imine groups, while its fluorinated aromatic rings may contribute to increased thermal stability and resistance to oxidation. The imine functionalities can participate in various chemical reactions, including nucleophilic additions and condensation reactions, making this compound potentially useful in organic synthesis and materials science. Additionally, the presence of multiple fluorine atoms may influence its physical properties, such as melting point and boiling point, as well as its interaction with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Overall, (1E,5E)-N,N'-bis[(pentafluorobenzyl)oxy]pentane-1,5-diimine represents a complex and versatile chemical entity with interesting properties for further exploration.
Formula:C19H12F10N2O2
InChI:InChI=1/C19H12F10N2O2/c20-10-8(11(21)15(25)18(28)14(10)24)6-32-30-4-2-1-3-5-31-33-7-9-12(22)16(26)19(29)17(27)13(9)23/h4-5H,1-3,6-7H2/b30-4+,31-5+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.