CAS 932710-51-5

1-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoyl)pyrrolidine-2,5-dione

Description:

1-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoyl)pyrrolidine-2,5-dione, with CAS number 932710-51-5, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and a tridecafluorononanoyl moiety. This compound features multiple fluorinated carbon chains, contributing to its unique chemical properties, such as increased hydrophobicity and thermal stability. The presence of the pyrrolidine-2,5-dione structure suggests potential reactivity typical of diketones, which may participate in various chemical reactions, including nucleophilic additions. The fluorinated segments enhance its lipophilicity, making it potentially useful in applications such as surfactants, coatings, or pharmaceuticals. Additionally, the compound's fluorinated nature may impart specific biological activities or interactions, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₃H₈F₁₃NO₃

InChI: InChI=1/C13H8F13NO3/c14-8(15,4-3-7(30)27-5(28)1-2-6(27)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-4H2

SMILES: C1CC(=O)N(C1=O)C(=O)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F