CAS 932710-53-7
:(1E)-N-[(pentafluorobenzyl)oxy]propan-1-imine
Description:
(1E)-N-[(pentafluorobenzyl)oxy]propan-1-imine is an organic compound characterized by its imine functional group, which features a carbon-nitrogen double bond. The presence of the pentafluorobenzyl group indicates that the compound has significant fluorine substitution, which can impart unique electronic and steric properties, enhancing its reactivity and stability. The pentafluorobenzyl moiety is known for its strong electron-withdrawing effects due to the electronegativity of fluorine atoms, which can influence the compound's overall polarity and solubility in various solvents. This compound may exhibit interesting chemical behavior, such as potential applications in medicinal chemistry or materials science, owing to its distinctive structure. Additionally, the imine functionality can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Overall, (1E)-N-[(pentafluorobenzyl)oxy]propan-1-imine represents a complex organic molecule with potential utility in specialized chemical applications.
Formula:C10H8F5NO
InChI:InChI=1/C10H8F5NO/c1-2-3-16-17-4-5-6(11)8(13)10(15)9(14)7(5)12/h3H,2,4H2,1H3/b16-3+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(1E)-N-[(Pentafluorobenzyl)oxy]-1-propanimine
CAS:Pentafluorobenzyloxypropanimine is a speciality chemical that has been used as a useful intermediate in the synthesis of polymers, pharmaceuticals, and agrochemicals. This compound is also a versatile building block that can be used in the synthesis of complex compounds. It has been shown to be an excellent reagent for the preparation of fine chemicals.
Formula:C10H8F5NOPurity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:253.17 g/mol
