CAS 932710-55-9
:N-[(2,3,4,5,6-pentafluorophenyl)methoxy]prop-2-en-1-imine
Description:
N-[(2,3,4,5,6-pentafluorophenyl)methoxy]prop-2-en-1-imine is a chemical compound characterized by its unique structure, which includes a prop-2-en-1-imine functional group and a pentafluorophenyl moiety. The presence of multiple fluorine atoms on the phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially altering its reactivity compared to non-fluorinated analogs. This compound is likely to exhibit high thermal stability and resistance to oxidation due to the strong C-F bonds. Additionally, the methoxy group contributes to its solubility in organic solvents. The imine functional group may participate in various chemical reactions, including nucleophilic addition and condensation reactions. Given its complex structure, this compound may have applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of fluorinated compounds that exhibit unique biological or physical properties. However, specific safety and handling guidelines should be followed due to the presence of fluorinated components, which can pose environmental and health risks.
Formula:C10H6F5NO
InChI:InChI=1/C10H6F5NO/c1-2-3-16-17-4-5-6(11)8(13)10(15)9(14)7(5)12/h2-3H,1,4H2/b16-3+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.