CymitQuimica logo

CAS 932710-57-1

:

[2,7-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-9H-fluoren-9-yl]methyl chlorocarbonate

Description:
The chemical substance known as [2,7-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-9H-fluoren-9-yl]methyl chlorocarbonate, with the CAS number 932710-57-1, is a specialized organic compound characterized by its complex structure, which includes a fluorenyl moiety and multiple tridecafluorooctyl groups. This compound is likely to exhibit unique properties due to the presence of fluorinated alkyl chains, which can impart hydrophobicity and enhance thermal stability. The chlorocarbonate functional group suggests potential reactivity, particularly in nucleophilic substitution reactions, making it useful in various chemical applications, including polymer synthesis and surface modification. Its fluorinated nature may also contribute to low surface energy, making it suitable for applications in coatings and materials science. However, specific safety and handling guidelines should be followed due to the potential hazards associated with chlorocarbonates and fluorinated compounds. Overall, this substance represents a niche area of study within organic and materials chemistry, with implications for advanced material development.
Formula:C31H17ClF26O2
InChI:InChI=1/C31H17ClF26O2/c32-19(59)60-11-18-16-9-12(5-7-20(33,34)22(37,38)24(41,42)26(45,46)28(49,50)30(53,54)55)1-3-14(16)15-4-2-13(10-17(15)18)6-8-21(35,36)23(39,40)25(43,44)27(47,48)29(51,52)31(56,57)58/h1-4,9-10,18H,5-8,11H2
SMILES:c1cc2c3ccc(CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)cc3C(COC(=O)Cl)c2cc1CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.