
CAS 932738-81-3
:2-Chloro-4-(1-ethoxyethenyl)pyrimidine
Description:
2-Chloro-4-(1-ethoxyethenyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a chloro substituent at the 2-position and an ethoxyethenyl group at the 4-position, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the chloro group enhances electrophilicity, making it a useful intermediate in various chemical reactions. Additionally, the ethoxyethenyl moiety can participate in further transformations, such as polymerization or cross-coupling reactions. The compound's solubility and stability can vary depending on the solvent and conditions, which are important considerations for its handling and application. As with many pyrimidine derivatives, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data and handling precautions should be observed due to the presence of the chlorine atom, which can impart toxicity.
Formula:C8H9ClN2O
InChI:InChI=1S/C8H9ClN2O/c1-3-12-6(2)7-4-5-10-8(9)11-7/h4-5H,2-3H2,1H3
InChI key:InChIKey=DIOXYZRXAFUDEK-UHFFFAOYSA-N
SMILES:C(OCC)(=C)C1=NC(Cl)=NC=C1
Synonyms:- Pyrimidine, 2-chloro-4-(1-ethoxyethenyl)-
- 2-Chloro-4-(1-ethoxyvinyl)pyrimidine
- 2-Chloro-4-(1-ethoxyethenyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.