CAS 932742-86-4
:4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzylamine
Description:
4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzylamine is an organic compound characterized by its unique structure, which includes a benzylamine moiety linked to a 5-methyl-1,2,4-oxadiazole ring. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals and agrochemicals due to its bioactivity and ability to participate in various chemical reactions. The methyl group on the oxadiazole enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic and heterocyclic systems. Its synthesis often involves standard organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and elemental analysis. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the amine functional group, which can be reactive.
Formula:C10H11N3O
InChI:InChI=1/C10H11N3O/c1-7-12-10(13-14-7)9-4-2-8(6-11)3-5-9/h2-5H,6,11H2,1H3
SMILES:Cc1nc(c2ccc(cc2)CN)no1
Synonyms:- 1-[4-(5-Methyl-1,2,4-oxadiazol-3-yl)phenyl]methanamine
- Benzenemethanamine, 4-(5-Methyl-1,2,4-Oxadiazol-3-Yl)-
- [4-(5-Methyl-1,2,4-Oxadiazol-3-Yl)Phenyl]Methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.