CAS 93277-96-4
:Altapizone
Description:
Altapizone, identified by its CAS number 93277-96-4, is a chemical compound that belongs to the class of substances known as anti-inflammatory agents. It is primarily characterized by its ability to inhibit the activity of certain enzymes involved in the inflammatory process, making it useful in the treatment of conditions associated with inflammation and pain. The compound exhibits a specific molecular structure that contributes to its pharmacological properties, including its solubility and stability under various conditions. Altapizone is typically administered in a controlled dosage to ensure efficacy while minimizing potential side effects. As with many pharmaceutical agents, its safety profile and therapeutic effects are evaluated through clinical studies, which assess its impact on human health. Additionally, the compound's interactions with other medications and its metabolic pathways are important considerations in its application in medical treatments. Overall, Altapizone represents a significant advancement in the development of anti-inflammatory therapies.
Formula:C23H26N4O2
InChI:InChI=1/C23H26N4O2/c28-22-11-10-21(25-26-22)18-6-8-19(9-7-18)24-23(29)16-17-12-14-27(15-13-17)20-4-2-1-3-5-20/h1-9,17H,10-16H2,(H,24,29)(H,26,28)
Synonyms:- UNII-SW3OJS6TOD
- 4-Phenyl-4'-(1,4,5,6-tetrahydro-6-oxo-3-pyridazinyl)-1-piperidinepropionanilide
- Altapizone [INN]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
