CymitQuimica logo

CAS 932796-26-4

:

6-Chloro-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid

Description:
6-Chloro-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 6-position and a propoxyphenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the chloro group may also impart specific electronic effects, potentially affecting the compound's biological activity. This compound is of interest in medicinal chemistry and may exhibit pharmacological properties, making it a candidate for further research in drug development. Its molecular structure suggests potential interactions with biological targets, and its solubility profile can be influenced by the propoxy group. Overall, 6-Chloro-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C19H16ClNO3
InChI:InChI=1S/C19H16ClNO3/c1-2-8-24-14-5-3-4-12(9-14)18-11-16(19(22)23)15-10-13(20)6-7-17(15)21-18/h3-7,9-11H,2,8H2,1H3,(H,22,23)
InChI key:InChIKey=OHDVLYFIKIQYBN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C=CC(Cl)=C2
Synonyms:
  • 6-Chloro-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 6-chloro-2-(3-propoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.