CAS 932830-53-0
:4-Cyclopropyl-5-[1-(ethylsulfonyl)-3-piperidinyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-Cyclopropyl-5-[1-(ethylsulfonyl)-3-piperidinyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features a cyclopropyl group and an ethylsulfonyl substituent attached to a piperidine moiety, contributing to its potential biological activity. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) suggests that it may exhibit properties typical of thioketones, potentially influencing its reactivity and interactions with biological targets. The compound's structure indicates it may be of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its CAS number, 932830-53-0, allows for precise identification and retrieval of information regarding its synthesis, properties, and safety data. As with many compounds in this class, understanding its solubility, stability, and reactivity under various conditions is crucial for its application in research and development.
Formula:C12H20N4O2S2
InChI:InChI=1S/C12H20N4O2S2/c1-2-20(17,18)15-7-3-4-9(8-15)11-13-14-12(19)16(11)10-5-6-10/h9-10H,2-8H2,1H3,(H,14,19)
InChI key:InChIKey=ZBPUNXHHHSGFCT-UHFFFAOYSA-N
SMILES:S=C1N(C(=NN1)C2CN(S(CC)(=O)=O)CCC2)C3CC3
Synonyms:- 4-Cyclopropyl-5-[1-(ethylsulfonyl)-3-piperidinyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
- 3H-1,2,4-Triazole-3-thione, 4-cyclopropyl-5-[1-(ethylsulfonyl)-3-piperidinyl]-2,4-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.