CAS 932928-94-4
:6-Chloro-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid
Description:
6-Chloro-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline core, which is a bicyclic structure containing a nitrogen atom. The presence of a chloro substituent at the 6-position and a bulky 1-methylpropyl group at the para position of the phenyl ring contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the hydrophobic alkyl substituent, which may influence its biological activity and solubility in organic solvents. The carboxylic acid functional group at the 4-position enhances its potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. Additionally, the compound may possess pharmacological properties, as many quinoline derivatives are known for their biological activities, including antimicrobial and anti-inflammatory effects. Its specific applications and behavior in biological systems would depend on further studies and evaluations.
Formula:C20H18ClNO2
InChI:InChI=1S/C20H18ClNO2/c1-3-12(2)13-4-6-14(7-5-13)19-11-17(20(23)24)16-10-15(21)8-9-18(16)22-19/h4-12H,3H2,1-2H3,(H,23,24)
InChI key:InChIKey=VFWDFWOLNYYDQE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(CC)C)C=C3)C=CC(Cl)=C2
Synonyms:- 6-Chloro-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarboxylic acid
- 4-Quinolinecarboxylic acid, 6-chloro-2-[4-(1-methylpropyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.