CymitQuimica logo

CAS 932928-98-8

:

6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid

Description:
6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group and a phenyl moiety that carries a branched alkoxy side chain. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects, although specific biological data may vary. The presence of the chloro substituent can influence its reactivity and solubility, while the alkoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound's carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Overall, this compound's unique structural features suggest it may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C20H18ClNO3
InChI:InChI=1S/C20H18ClNO3/c1-12(2)11-25-15-6-3-13(4-7-15)19-10-17(20(23)24)16-9-14(21)5-8-18(16)22-19/h3-10,12H,11H2,1-2H3,(H,23,24)
InChI key:InChIKey=WTPJSXWDSCIDFQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C=CC(Cl)=C2
Synonyms:
  • 6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 6-chloro-2-[4-(2-methylpropoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.