CAS 932929-02-7

6-Chloro-2-(2-propoxyphenyl)-4-quinolinecarboxylic acid

Description:

6-Chloro-2-(2-propoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 6-position and a propoxyphenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for forming salts or esters. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, possibly influencing its solubility and permeability. The presence of the chloro group can also affect its reactivity and stability. As with many quinoline derivatives, it may possess antimicrobial or antitumor properties, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₉H₁₆ClNO₃

InChI: InChI=1S/C19H16ClNO3/c1-2-9-24-18-6-4-3-5-13(18)17-11-15(19(22)23)14-10-12(20)7-8-16(14)21-17/h3-8,10-11H,2,9H2,1H3,(H,22,23)

InChI key: InChIKey=XKKTYWVWMMYZAI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=C(OCCC)C=CC=C3)C=CC(Cl)=C2

Synonyms:

• 6-Chloro-2-(2-propoxyphenyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-chloro-2-(2-propoxyphenyl)-