CAS 93297-76-8

2′-Chloro-2,4′-bipyridine

Description:

2′-Chloro-2,4′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a chlorine atom at the 2′ position of one of the pyridine rings imparts unique chemical properties, including increased reactivity and potential for substitution reactions. This compound typically appears as a solid at room temperature and is soluble in organic solvents. It is often utilized in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. The chlorine substituent can influence the compound's electronic properties, making it useful in coordination chemistry and catalysis. Additionally, 2′-Chloro-2,4′-bipyridine may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, its structural features and reactivity make it a valuable compound in both industrial and research settings.

Formula: C₁₀H₇ClN₂

InChI: InChI=1S/C10H7ClN2/c11-10-7-8(4-6-13-10)9-3-1-2-5-12-9/h1-7H

InChI key: InChIKey=NOCHWFIBGJHUFF-UHFFFAOYSA-N

SMILES: ClC1=CC(=CC=N1)C2=CC=CC=N2

Synonyms:

• 2,4′-Bipyridine, 2′-chloro-
• 2′-Chloro-2,4′-bipyridine