CAS 933-05-1
:Cycloamyl acetate
Description:
Cycloamyl acetate, with the CAS number 933-05-1, is an organic compound classified as an ester. It is derived from cycloamylose and acetic acid, featuring a cyclohexane ring structure that contributes to its unique properties. This colorless to pale yellow liquid is known for its pleasant, fruity odor, making it a popular choice in the fragrance and flavoring industries. Cycloamyl acetate is relatively non-toxic and has a low volatility, which enhances its stability in various applications. It is soluble in organic solvents but has limited solubility in water. The compound is often used as a flavoring agent in food products and as a fragrance component in perfumes and cosmetics. Additionally, it may serve as an intermediate in organic synthesis. Due to its chemical structure, cycloamyl acetate exhibits characteristics typical of esters, such as being less dense than water and having a lower boiling point compared to its corresponding acids. Safety data should always be consulted for handling and usage guidelines.
Formula:C7H12O2
InChI:InChI=1/C7H12O2/c1-6(8)9-7-4-2-3-5-7/h7H,2-5H2,1H3
InChI key:InChIKey=YFPCLQKFNXUAAK-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1CCCC1
Synonyms:- Cyclopentanol, acetate
- Cyclopentanol, 1-acetate
- Cycloamyl acetate
- Cyclopentyl acetate
- NSC 55885
- Acetic acid cyclopentyl ester
- cyclopentyl ethanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.