CAS 933-41-5

1-Thia-4-azaspiro[4.5]decane, hydrochloride (1:1)

Description:

1-Thia-4-azaspiro[4.5]decane, hydrochloride (1:1), with the CAS number 933-41-5, is a chemical compound characterized by its unique spirocyclic structure, which includes both sulfur and nitrogen atoms in its framework. This compound features a bicyclic system where a nitrogen atom is part of a five-membered ring, and a sulfur atom is integrated into the structure, contributing to its heterocyclic nature. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically enhances its solubility in water and may influence its pharmacological properties. Such compounds often exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the spiro structure can impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Overall, 1-Thia-4-azaspiro[4.5]decane, hydrochloride is notable for its structural complexity and potential applications in various fields, including pharmaceuticals.

Formula: C₈H₁₅NS·ClH

InChI: InChI=1S/C8H15NS.ClH/c1-2-4-8(5-3-1)9-6-7-10-8;/h9H,1-7H2;1H

InChI key: InChIKey=IOASODGEZSLHHY-UHFFFAOYSA-N

SMILES: C12(CCCCC1)NCCS2.Cl

Synonyms:

• 1-Thia-4-azaspiro[4.5]decane, hydrochloride
• 1-Thia-4-azaspiro[4.5]decane, hydrochloride (1:1)

1-Thia-4-azaspiro[4.5]decane hydrochloride

CAS: 933-41-5

1-Thia-4-azaspiro[4.5]decane hydrochloride

Purity: 95%

Molecular weight: 193.74g/mol

Ref: 54-OR33498