CAS 933-49-3
:5,6-Dihydro-4,6,6-trimethyl-2(1H)-pyrimidinethione
Description:
5,6-Dihydro-4,6,6-trimethyl-2(1H)-pyrimidinethione, with the CAS number 933-49-3, is a heterocyclic organic compound characterized by a pyrimidine ring structure that features a thione functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure includes three methyl groups attached to the pyrimidine ring, contributing to its unique chemical properties and potential reactivity. The thione group imparts specific characteristics, such as the ability to participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H12N2S
InChI:InChI=1S/C7H12N2S/c1-5-4-7(2,3)9-6(10)8-5/h4H2,1-3H3,(H,9,10)
InChI key:InChIKey=YIAPPMPDJXJYFU-UHFFFAOYSA-N
SMILES:CC1(C)CC(C)=NC(=S)N1
Synonyms:- 5,6-Dihydro-4,6,6-trimethyl-2(1H)-pyrimidinethione
- 2(1H)-Pyrimidinethione, 5,6-dihydro-4,6,6-trimethyl-
- 4,6,6-Trimethyl-5,6-dihydropyrimidine-2(1H)-thione
- 4,5-DIHYDRO-4,4,6-TRIMETHYL-2-PYRIMIDINETHIOL
- 4,4,6-Trimethyl-4,5-dihydropyrimidine-2-thiol
- 4,4,6-trimethyl-3,5-dihydropyrimidine-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.