CAS 933-92-6
:Methyl 2-hydroxycyclopentanecarboxylate
Description:
Methyl 2-hydroxycyclopentanecarboxylate, with the CAS number 933-92-6, is an organic compound characterized by its ester functional group and a cyclopentane ring structure. This compound features a hydroxyl group (-OH) and a carboxylate group (-COO-) attached to the cyclopentane ring, which contributes to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. The presence of the hydroxyl group enhances its polarity, allowing for better solubility in polar solvents. Methyl 2-hydroxycyclopentanecarboxylate can participate in various chemical reactions, including esterification and nucleophilic substitution, making it a valuable intermediate in organic synthesis. Additionally, its structural features may impart specific biological activities, warranting further investigation in pharmaceutical research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c1-10-7(9)5-3-2-4-6(5)8/h5-6,8H,2-4H2,1H3
SMILES:COC(=O)C1CCCC1O
Synonyms:- Cyclopentanecarboxylic Acid, 2-Hydroxy-, Methyl Ester
- Methyl 2-Hydroxycyclopentylcarboxylate
- 2-Hydroxy-Cyclopentanecarboxylic Acid Methyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
