
CAS 933030-90-1
:1,4-Dihydro-4-oxo-2-pyridinecarboxaldehyde
Description:
1,4-Dihydro-4-oxo-2-pyridinecarboxaldehyde, with the CAS number 933030-90-1, is a heterocyclic organic compound featuring a pyridine ring. This compound is characterized by the presence of a carbonyl group (C=O) and an aldehyde group (–CHO) attached to the pyridine structure. It typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in synthesizing other chemical entities. Its reactivity is influenced by the functional groups present, allowing it to participate in various chemical reactions, such as condensation and oxidation. The compound's properties, including melting point, boiling point, and spectral data, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C6H5NO2
InChI:InChI=1S/C6H5NO2/c8-4-5-3-6(9)1-2-7-5/h1-4H,(H,7,9)
InChI key:InChIKey=KBYYSTCVMSMKSP-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=O)C=CN1
Synonyms:- 2-Pyridinecarboxaldehyde, 1,4-dihydro-4-oxo-
- 1,4-Dihydro-4-oxo-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.