CymitQuimica logo

CAS 933035-36-0

:

8-Bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine

Description:
8-Bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its complex structure, which includes a fused imidazole and pyridazine ring system. This compound features three halogen substituents: bromine, chlorine, and fluorine, which significantly influence its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Typically, such compounds exhibit a range of potential applications, including use as pharmaceuticals or agrochemicals, due to their ability to interact with biological targets. The molecular structure contributes to its stability and reactivity, with the imidazo and pyridazine moieties providing sites for further chemical modifications. Additionally, the compound's unique combination of halogens may impart specific electronic properties, influencing its behavior in various chemical environments. Overall, 8-Bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine represents a valuable compound for research and development in various chemical fields.
Formula:C6H2BrClFN3
InChI:InChI=1S/C6H2BrClFN3/c7-3-1-4(8)11-12-5(9)2-10-6(3)12/h1-2H
InChI key:InChIKey=WXWFQLXRQAUZTO-UHFFFAOYSA-N
SMILES:BrC=1C=2N(N=C(Cl)C1)C(F)=CN2
Synonyms:
  • Imidazo[1,2-b]pyridazine, 8-bromo-6-chloro-3-fluoro-
  • 8-Bromo-6-chloro-3-fluoroimidazo[1,2-b]pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.