CAS 933054-29-6
:sodium 3-(3-bromophenyl)-3-oxo-propanal
Description:
Sodium 3-(3-bromophenyl)-3-oxo-propanal, identified by its CAS number 933054-29-6, is a chemical compound that features a sodium salt of a propanal derivative. This compound typically exhibits characteristics associated with both aldehydes and ketones due to the presence of the oxo group and the aldehyde functional group. The bromophenyl substituent contributes to its aromatic properties, potentially influencing its reactivity and solubility. Generally, compounds like this may be soluble in polar solvents due to the presence of the sodium ion, which can enhance solubility in aqueous environments. The presence of the bromine atom can also impart unique electronic properties, affecting the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry or material science. Overall, sodium 3-(3-bromophenyl)-3-oxo-propanal is characterized by its functional groups, solubility profile, and potential reactivity, which are essential for its applications in various chemical contexts.
Formula:C9H6BrNaO2
InChI:InChI=1/C9H6BrO2.Na/c10-8-3-1-2-7(6-8)9(12)4-5-11;/h1-6H;/q-1;+1
SMILES:c1cc(cc(c1)Br)C(=O)[CH-]C=O.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.