CAS 93316-40-6
:(3R)-2-(phenylcarbonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate
Description:
The chemical substance known as (3R)-2-(phenylcarbonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylate, with the CAS number 93316-40-6, is a derivative of tetrahydroisoquinoline, a bicyclic compound that features a nitrogen atom within its structure. This compound exhibits characteristics typical of isoquinoline derivatives, including potential biological activity due to its structural complexity. The presence of the phenylcarbonyl group suggests that it may participate in various chemical reactions, such as acylation or nucleophilic attacks, and could exhibit properties such as solubility in organic solvents. The stereochemistry indicated by the (3R) configuration implies that the compound has specific spatial arrangements that may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the carboxylate functional group may contribute to its acidity and reactivity, potentially affecting its pharmacokinetic properties. Overall, this compound may have applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C17H14NO3
InChI:InChI=1/C17H15NO3/c19-16(12-6-2-1-3-7-12)18-11-14-9-5-4-8-13(14)10-15(18)17(20)21/h1-9,15H,10-11H2,(H,20,21)/p-1/t15-/m1/s1
SMILES:c1ccc(cc1)C(=O)N1Cc2ccccc2C[C@@H]1C(=O)[O-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Benzoyl-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid
CAS:Formula:C17H15NO3Molecular weight:281.3059
