CymitQuimica logo

CAS 93336-22-2

:

3-(2-methylpyridin-1(2H)-yl)propanamide

Description:
3-(2-Methylpyridin-1(2H)-yl)propanamide, with the CAS number 93336-22-2, is an organic compound characterized by its amide functional group and a pyridine ring. The structure features a propanamide backbone, which is linked to a 2-methylpyridine moiety. This compound exhibits properties typical of amides, such as moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The methyl group on the pyridine ring can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. Additionally, the presence of the pyridine ring may impart basicity to the compound, allowing it to participate in various chemical reactions. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C9H14N2O
InChI:InChI=1/C9H14N2O/c1-8-4-2-3-6-11(8)7-5-9(10)12/h2-4,6,8H,5,7H2,1H3,(H2,10,12)
SMILES:CC1C=CC=CN1CCC(=N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.