
CAS 93338-64-8
:Methyl 4-aminopentanoate
Description:
Methyl 4-aminopentanoate, with the CAS number 93338-64-8, is an organic compound characterized by its amine and ester functional groups. It features a pentanoate backbone, which consists of a five-carbon chain, with an amino group (-NH2) located at the fourth carbon position. This structure imparts both hydrophilic and hydrophobic properties, making it soluble in various organic solvents while exhibiting some degree of water solubility. Methyl 4-aminopentanoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is often used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to its ability to act as an intermediate in the formation of more complex molecules. Additionally, the presence of the amino group allows for potential reactivity in various chemical reactions, such as acylation or alkylation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H13NO2
InChI:InChI=1S/C6H13NO2/c1-5(7)3-4-6(8)9-2/h5H,3-4,7H2,1-2H3
InChI key:InChIKey=NHMQROWVIOFGNH-UHFFFAOYSA-N
SMILES:C(CCC(C)N)(OC)=O
Synonyms:- Methyl 4-aminopentanoate
- Pentanoic acid, 4-amino-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.