CAS 93345-44-9
:Disulfide, diphenyl, homopolymer
Description:
Disulfide, diphenyl, homopolymer, identified by the CAS number 93345-44-9, is a polymeric compound characterized by the presence of disulfide linkages within its structure. This substance is typically formed through the polymerization of diphenyl disulfide, resulting in a network of interconnected polymer chains that exhibit unique properties. The presence of disulfide bonds imparts significant thermal stability and enhances the material's resistance to oxidative degradation. Additionally, diphenyl disulfide homopolymer may exhibit good mechanical strength and elasticity, making it suitable for various applications, including adhesives, coatings, and rubber-like materials. Its chemical structure allows for potential modifications, enabling the tailoring of properties for specific uses. The polymer's solubility and compatibility with other materials can vary, depending on its molecular weight and the degree of cross-linking. Overall, disulfide, diphenyl, homopolymer represents a versatile class of materials with applications in industrial and commercial sectors.
Formula:(C12H10S2)x
InChI:InChI=1S/C12H10S2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H
InChI key:InChIKey=GUUVPOWQJOLRAS-UHFFFAOYSA-N
SMILES:S(SC1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Disulfide, diphenyl, homopolymer
- Diphenyl disulfide homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
