CAS 933471-46-6

Methyl (βS)-β-amino-3-methoxybenzenepropanoate

Description:

Methyl (βS)-β-amino-3-methoxybenzenepropanoate, with the CAS number 933471-46-6, is an organic compound characterized by its structure, which includes a methoxy group and an amino group attached to a propanoate backbone. This compound typically exhibits properties associated with amino acids and esters, such as solubility in polar solvents due to the presence of the amino and methoxy functional groups. The β-amino configuration suggests that it may participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. Its methoxy group can influence its reactivity and interaction with biological systems, potentially affecting its pharmacological properties. The compound may also exhibit chirality, which can impact its biological activity and interactions with enzymes or receptors. Overall, Methyl (βS)-β-amino-3-methoxybenzenepropanoate is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-14-9-5-3-4-8(6-9)10(12)7-11(13)15-2/h3-6,10H,7,12H2,1-2H3/t10-/m0/s1

InChI key: InChIKey=DOYKYXMRPXMHLZ-JTQLQIEISA-N

SMILES: [C@@H](CC(OC)=O)(N)C1=CC(OC)=CC=C1

Synonyms:

• Methyl (βS)-β-amino-3-methoxybenzenepropanoate
• Benzenepropanoic acid, β-amino-3-methoxy-, methyl ester, (βS)-