CAS 933486-43-2
:4-bromo-7-nitroquinoline
Description:
4-Bromo-7-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a bromine atom at the 4-position and a nitro group at the 7-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in medicinal chemistry, particularly in the development of antimicrobial and anticancer agents. The nitro group is a strong electron-withdrawing group, which can influence the compound's reactivity and interaction with biological targets. Additionally, the bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. 4-Bromo-7-nitroquinoline may also exhibit fluorescence properties, making it useful in certain analytical applications. As with many nitro-containing compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C9H5BrN2O2
InChI:InChI=1/C9H5BrN2O2/c10-8-3-4-11-9-5-6(12(13)14)1-2-7(8)9/h1-5H
SMILES:c1cc2c(ccnc2cc1N(=O)=O)Br
Synonyms:- Quinoline, 4-Bromo-7-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
