CAS 93349-97-4
:Methyl 5-(2-furanyl)-3-pyridinecarboxylate
Description:
Methyl 5-(2-furanyl)-3-pyridinecarboxylate, with the CAS number 93349-97-4, is an organic compound characterized by its unique structure that combines a pyridine ring and a furan moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its potential applications in the fields of pharmaceuticals and agrochemicals. The presence of both the furan and pyridine rings suggests that it may exhibit interesting biological activities, including potential antimicrobial or anti-inflammatory effects. Methyl 5-(2-furanyl)-3-pyridinecarboxylate is likely to be soluble in organic solvents, such as ethanol and dichloromethane, while exhibiting limited solubility in water due to its hydrophobic characteristics. As with many organic compounds, handling should be done with care, following appropriate safety protocols to avoid exposure. Overall, this compound represents a valuable structure for further research and development in various chemical applications.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-14-11(13)9-5-8(6-12-7-9)10-3-2-4-15-10/h2-7H,1H3
InChI key:InChIKey=RYVDVDJYZUZXKK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(=CN=C1)C2=CC=CO2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(2-furanyl)-, methyl ester
- Methyl 5-(2-furanyl)-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
