CAS 93349-99-6

3-Pyridinecarboxylic acid, 5-bromo-6-methoxy-, methyl ester

Description:

3-Pyridinecarboxylic acid, 5-bromo-6-methoxy-, methyl ester, identified by CAS number 93349-99-6, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that is esterified with a methyl group, indicating it is a methyl ester. The presence of bromine and methoxy groups at the 5 and 6 positions, respectively, contributes to its unique chemical properties and reactivity. Typically, such compounds exhibit moderate polarity due to the presence of the carboxylate and methoxy groups, which can influence solubility in various solvents. The bromine substituent may also impart specific reactivity, making it useful in various synthetic applications. Additionally, the compound may exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Overall, this compound's structure suggests potential utility in medicinal chemistry and organic synthesis.

Formula: C₈H₈BrNO₃

InChI: InChI=1S/C8H8BrNO3/c1-12-7-6(9)3-5(4-10-7)8(11)13-2/h3-4H,1-2H3

InChI key: InChIKey=UCOBYBCUAQNLBK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(Br)C(OC)=NC1

Synonyms:

• 5-Bromo-6-methoxynicotinic acid methyl ester
• Methyl 5-Bromo-6-methoxynicotinate
• Methyl 5-bromo-6-methoxypyridine-3-carboxylate
• 3-Pyridinecarboxylic acid, 5-bromo-6-methoxy-, methyl ester

5-Bromo-6-methoxynicotinic acid methyl ester

CAS: 93349-99-6

Formula: C₈H₈BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.0580

Ref: IN-DA00H0JP

Methyl 5-bromo-6-methoxynicotinate

CAS: 93349-99-6

Methyl 5-bromo-6-methoxynicotinate

Purity: 97%

Color and Shape: White Powder

Molecular weight: 246.06g/mol

Ref: 54-OR313072

Methyl 5-bromo-6-methoxynicotinate

CAS: 93349-99-6

Formula: C₈H₈BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.06

Ref: 10-F050484