CAS 933585-10-5
:Phenol, 3-bromo-4-chloro-, 1-acetate
Description:
Phenol, 3-bromo-4-chloro-, 1-acetate, with the CAS number 933585-10-5, is an organic compound that belongs to the class of halogenated phenols. This substance features a phenolic structure substituted with both bromine and chlorine atoms, which can influence its reactivity and biological activity. The presence of the acetate group indicates that it is an ester, which can affect its solubility and stability. Generally, halogenated phenols exhibit unique properties such as increased lipophilicity and potential antimicrobial activity. The specific arrangement of the bromine and chlorine substituents can lead to variations in the compound's physical properties, such as melting and boiling points, as well as its reactivity in chemical reactions. Additionally, compounds like this may be of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential applications in synthesis and as intermediates in chemical reactions. Safety and handling precautions are essential when working with halogenated compounds due to their potential toxicity and environmental impact.
Formula:C8H6BrClO2
InChI:InChI=1S/C8H6BrClO2/c1-5(11)12-6-2-3-8(10)7(9)4-6/h2-4H,1H3
InChI key:InChIKey=VMVBCMAJKOGSAV-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=CC(Br)=C(Cl)C=C1
Synonyms:- 3-Bromo-4-chlorophenyl acetate
- Phenol, 3-bromo-4-chloro-, 1-acetate
- 1-Acetoxy-3-bromo-4-chlorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
