CAS 93363-02-1
:N-(3-chlorophenyl)-3-(pyridin-3-yl)-1H-pyrrolo[1,2-c][1,3]thiazole-7-carboxamide
Description:
N-(3-chlorophenyl)-3-(pyridin-3-yl)-1H-pyrrolo[1,2-c][1,3]thiazole-7-carboxamide is a chemical compound characterized by its complex structure, which includes a pyrrolo-thiazole core fused with a pyridine and a chlorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the thiazole and pyridine rings suggests that it may interact with biological targets, potentially influencing various biochemical pathways. The chlorophenyl substituent may enhance lipophilicity, affecting the compound's solubility and permeability. Additionally, the carboxamide functional group can participate in hydrogen bonding, which is crucial for molecular interactions in biological systems. Overall, this compound's unique structural features may contribute to its pharmacological properties, warranting further investigation for applications in drug development or as a research tool in biochemistry.
Formula:C18H14ClN3OS
InChI:InChI=1/C18H14ClN3OS/c19-13-4-1-5-14(9-13)21-17(23)15-6-8-22-16(15)11-24-18(22)12-3-2-7-20-10-12/h1-10,18H,11H2,(H,21,23)
Synonyms:- 1H,3H-pyrrolo[1,2-c]thiazole-7-carboxamide, N-(3-chlorophenyl)-3-(3-pyridinyl)-
- N-(3-Chlorophenyl)-3-(pyridin-3-yl)-1H-pyrrolo[1,2-c][1,3]thiazole-7-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
RP-52770
CAS:RP-52770 is a bioactive chemical.Formula:C18H14ClN3OSColor and Shape:SolidMolecular weight:355.84
