
CAS 93366-89-3
:7-(2-Deoxy-β-D-erythro-pentofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine
Description:
7-(2-Deoxy-β-D-erythro-pentofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine is a nucleoside analog characterized by its unique structure, which combines a pyrrolo[2,3-d]pyrimidine core with a deoxyribose sugar moiety. This compound features a fused bicyclic system that contributes to its potential biological activity, particularly in the context of antiviral and anticancer research. The presence of the 2-deoxy sugar enhances its stability and bioavailability compared to ribonucleosides. Its molecular structure allows for interactions with nucleic acid targets, potentially inhibiting nucleic acid synthesis or modifying cellular processes. The compound's CAS number, 93366-89-3, facilitates its identification in chemical databases and literature. As a synthetic derivative, it may exhibit unique pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, the characteristics of this compound suggest its relevance in the development of therapeutic agents, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C11H13N3O3
InChI:InChI=1S/C11H13N3O3/c15-5-9-8(16)3-10(17-9)14-2-1-7-4-12-6-13-11(7)14/h1-2,4,6,8-10,15-16H,3,5H2/t8-,9+,10+/m0/s1
InChI key:InChIKey=AEQRATFTZKRUBX-IVZWLZJFSA-N
SMILES:C(O)[C@H]1O[C@@H](N2C=3C(C=C2)=CN=CN3)C[C@@H]1O
Synonyms:- 2′-Deoxy-7-deazanebularine
- 7-(2-Deoxy-β-D-erythro-pentofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine
- 7H-Pyrrolo[2,3-d]pyrimidine, 7-(2-deoxy-β-D-erythro-pentofuranosyl)-
- 7-Deaza-2′-deoxynebularine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-(2-Deoxy-b-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine
CAS:Nucleoside Derivatives - 7-Deaza-purine nucleosides; 6-De-aminopurine nucleosidesFormula:C11H13N3O3Color and Shape:SolidMolecular weight:235.24Ref: TM-TNU1032
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
