CAS 933673-41-7
:1-[4-(1,1,2,3,3,3-Hexafluoropropoxy)phenyl]ethanone
Description:
1-[4-(1,1,2,3,3,3-Hexafluoropropoxy)phenyl]ethanone, with the CAS number 933673-41-7, is an organic compound characterized by its unique structure that includes a phenyl ring substituted with a hexafluoropropoxy group and an ethanone moiety. This compound is notable for its fluorinated functional group, which imparts distinct chemical properties such as increased hydrophobicity and thermal stability. The presence of fluorine atoms often enhances the compound's resistance to degradation and can influence its reactivity and solubility in various solvents. Additionally, the ethanone functional group contributes to its potential applications in organic synthesis and materials science. The compound may exhibit interesting optical and electronic properties due to its aromatic structure and substituents, making it a candidate for research in fields such as pharmaceuticals, agrochemicals, or advanced materials. Safety and handling precautions should be observed, as fluorinated compounds can pose environmental and health risks.
Formula:C11H8F6O2
InChI:InChI=1S/C11H8F6O2/c1-6(18)7-2-4-8(5-3-7)19-11(16,17)9(12)10(13,14)15/h2-5,9H,1H3
InChI key:InChIKey=IPXLXOSTJQDOLD-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)F)(OC1=CC=C(C(C)=O)C=C1)(F)F
Synonyms:- 1-[4-(1,1,2,3,3,3-Hexafluoropropoxy)phenyl]ethanone
- Ethanone, 1-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(1,1,2,3,3,3-Hexafluoropropoxy)acetophenone
CAS:<p>4-(1,1,2,3,3,3-Hexafluoropropoxy)acetophenone</p>Molecular weight:286.17044g/mol

