CAS 933673-45-1
:1-methoxy-5-methyl-4-nitro-2-(trifluoromethyl)benzene
Description:
1-Methoxy-5-methyl-4-nitro-2-(trifluoromethyl)benzene, with the CAS number 933673-45-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a methyl group (-CH3), a nitro group (-NO2), and a trifluoromethyl group (-CF3) attached to a benzene ring. This compound exhibits properties typical of substituted aromatic compounds, such as stability and the ability to undergo electrophilic substitution reactions. The presence of the electron-withdrawing nitro and trifluoromethyl groups can influence its reactivity and polarity, making it a potential candidate for various chemical applications, including in pharmaceuticals and agrochemicals. Additionally, the methoxy group can enhance solubility in organic solvents. The compound's unique combination of functional groups may also impart specific biological activities, making it of interest in medicinal chemistry. Safety and handling considerations should be observed due to the presence of the nitro group, which can be sensitive under certain conditions.
Formula:C9H8F3NO3
InChI:InChI=1/C9H8F3NO3/c1-5-3-8(16-2)6(9(10,11)12)4-7(5)13(14)15/h3-4H,1-2H3
SMILES:Cc1cc(c(cc1N(=O)=O)C(F)(F)F)OC
Synonyms:- Benzene, 1-methoxy-5-methyl-4-nitro-2-(trifluoromethyl)-
- Methyl 5-methyl-4-nitro-2-(trifluoromethyl)phenyl ether
- 2-Methoxy-4-methyl-5-nitrobenzotrifluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
