CymitQuimica logo

CAS 933674-67-0

:

4′-Methyl[1,1′-biphenyl]-3-thiol

Description:
4′-Methyl[1,1′-biphenyl]-3-thiol, identified by its CAS number 933674-67-0, is an organic compound characterized by the presence of a thiol (-SH) functional group attached to a biphenyl structure. This compound features a methyl group at the para position relative to the thiol group on one of the phenyl rings, which can influence its chemical reactivity and physical properties. The thiol group is known for its ability to form disulfide bonds and participate in redox reactions, making this compound potentially useful in various chemical applications, including organic synthesis and materials science. Additionally, the biphenyl framework contributes to the compound's stability and can affect its solubility in organic solvents. The presence of the methyl substituent may also impact the compound's electronic properties and steric hindrance. Overall, 4′-Methyl[1,1′-biphenyl]-3-thiol is of interest in research contexts, particularly in studies involving thiol chemistry and biphenyl derivatives.
Formula:C13H12S
InChI:InChI=1S/C13H12S/c1-10-5-7-11(8-6-10)12-3-2-4-13(14)9-12/h2-9,14H,1H3
InChI key:InChIKey=KBVMERBYECXYIE-UHFFFAOYSA-N
SMILES:SC=1C=C(C=CC1)C2=CC=C(C)C=C2
Synonyms:
  • 4′-Methyl[1,1′-biphenyl]-3-thiol
  • [1,1′-Biphenyl]-3-thiol, 4′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.