CAS 933674-80-7
:2-Chloro-6-[(trifluoromethyl)thio]benzothiazole
Description:
2-Chloro-6-[(trifluoromethyl)thio]benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole ring substituted with a chlorine atom and a trifluoromethylthio group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential biological activity and reactivity due to the presence of the chlorine and trifluoromethyl groups. The trifluoromethylthio group can enhance lipophilicity and influence the compound's interaction with biological targets, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of the benzothiazole moiety often correlates with antimicrobial and antifungal properties. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data and handling precautions should be considered due to the potential toxicity associated with halogenated compounds. Overall, 2-Chloro-6-[(trifluoromethyl)thio]benzothiazole represents a significant compound in the study of chemical reactivity and biological applications.
Formula:C8H3ClF3NS2
InChI:InChI=1S/C8H3ClF3NS2/c9-7-13-5-2-1-4(3-6(5)14-7)15-8(10,11)12/h1-3H
InChI key:InChIKey=UTFJXPIYUYAUNW-UHFFFAOYSA-N
SMILES:ClC1=NC=2C(=CC(SC(F)(F)F)=CC2)S1
Synonyms:- 2-Chloro-6-[(trifluoromethyl)thio]benzothiazole
- Benzothiazole, 2-chloro-6-[(trifluoromethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
