CAS 933674-88-5

4-[[4-[(Trifluoromethyl)thio]phenyl]sulfonyl]benzenamine

Description:

4-[[4-[(Trifluoromethyl)thio]phenyl]sulfonyl]benzenamine, identified by its CAS number 933674-88-5, is a chemical compound characterized by its complex structure that includes a sulfonamide functional group and a trifluoromethyl group. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, and the presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability. The sulfonyl group contributes to its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. In terms of physical properties, it may be a solid at room temperature, with solubility influenced by the presence of polar and nonpolar groups in its structure. The compound's unique characteristics make it of interest in medicinal chemistry and materials science, where it may be explored for its potential applications in drug development or as a building block in organic synthesis. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles.

Formula: C₁₃H₁₀F₃NO₂S₂

InChI: InChI=1S/C13H10F3NO2S2/c14-13(15,16)20-10-3-7-12(8-4-10)21(18,19)11-5-1-9(17)2-6-11/h1-8H,17H2

InChI key: InChIKey=VJOQFKOBRVOEEP-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(SC(F)(F)F)C=C1)C2=CC=C(N)C=C2

Synonyms:

• 4-[[4-[(Trifluoromethyl)thio]phenyl]sulfonyl]benzenamine
• Benzenamine, 4-[[4-[(trifluoromethyl)thio]phenyl]sulfonyl]-
• 4-(4-TRIFLUOROMETHYLSULFANYL-BENZENESULFONYL)-PHENYLAMINE